C23H27N7O4 — CID 68872168
4-[1-ethyl-6-[3-(3-morpholin-4-ylpropoxy)phenoxy]imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 68872168) has the molecular formula C23H27N7O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is 4-[1-ethyl-6-[3-(3-morpholin-4-ylpropoxy)phenoxy]imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[1-ethyl-6-[3-(3-morpholin-4-ylpropoxy)phenoxy]imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 68872168 |
| Molecular Formula | C23H27N7O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 4-[1-ethyl-6-[3-(3-morpholin-4-ylpropoxy)phenoxy]imidazo[4,5-c]pyridin-2-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | CCn1c(-c2nonc2N)nc2cnc(Oc3cccc(OCCCN4CCOCC4)c3)cc21 |
| InChI | InChI=1S/C23H27N7O4/c1-2-30-19-14-20(25-15-18(19)26-23(30)21-22(24)28-34-27-21)33-17-6-3-5-16(13-17)32-10-4-7-29-8-11-31-12-9-29/h3,5-6,13-15H,2,4,7-12H2,1H3,(H2,24,28) |
| InChIKey | WSFCREXJHNUTND-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|