C25H26F3N3O5S — CID 68872291
[2-(7-amino-1,1-dihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)-3-oxo-4,4-dipropylnaphthalen-1-yl] 2,2,2-trifluoroacetate (PubChem CID 68872291) has the molecular formula C25H26F3N3O5S and a molecular weight of 537.56 g/mol. Its IUPAC name is [2-(7-amino-1,1-dihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)-3-oxo-4,4-dipropylnaphthalen-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-(7-amino-1,1-dihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)-3-oxo-4,4-dipropylnaphthalen-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68872291 |
| Molecular Formula | C25H26F3N3O5S |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | [2-(7-amino-1,1-dihydroxy-4H-1λ4,2,4-benzothiadiazin-3-yl)-3-oxo-4,4-dipropylnaphthalen-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CCCC1(CCC)C(=O)C(C2=NS(O)(O)c3cc(N)ccc3N2)=C(OC(=O)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C25H26F3N3O5S/c1-3-11-24(12-4-2)16-8-6-5-7-15(16)20(36-23(33)25(26,27)28)19(21(24)32)22-30-17-10-9-14(29)13-18(17)37(34,35)31-22/h5-10,13,34-35H,3-4,11-12,29H2,1-2H3,(H,30,31) |
| InChIKey | NELFROCLNOQQLF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|