C21H22F3N5O — CID 68872341
5-[piperidin-4-yl-[4-(trifluoromethyl)phenyl]methoxy]quinazoline-2,4-diamine (PubChem CID 68872341) has the molecular formula C21H22F3N5O and a molecular weight of 417.44 g/mol. Its IUPAC name is 5-[piperidin-4-yl-[4-(trifluoromethyl)phenyl]methoxy]quinazoline-2,4-diamine.
| Compound Name | 5-[piperidin-4-yl-[4-(trifluoromethyl)phenyl]methoxy]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 68872341 |
| Molecular Formula | C21H22F3N5O |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 5-[piperidin-4-yl-[4-(trifluoromethyl)phenyl]methoxy]quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2c(OC(c3ccc(C(F)(F)F)cc3)C3CCNCC3)cccc2n1 |
| InChI | InChI=1S/C21H22F3N5O/c22-21(23,24)14-6-4-12(5-7-14)18(13-8-10-27-11-9-13)30-16-3-1-2-15-17(16)19(25)29-20(26)28-15/h1-7,13,18,27H,8-11H2,(H4,25,26,28,29) |
| InChIKey | PTVSXIVBSWDEMB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |