About prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate
prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate (PubChem CID 68872574) has the molecular formula C13H13NO4S
and a molecular weight of 279.32 g/mol. Its IUPAC name is prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate.
Molecular Properties
| Compound Name | prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate |
| PubChem CID | 68872574 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate |
| SMILES | C=CCOC(=O)CC1=CS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C13H13NO4S/c1-2-7-18-13(15)8-10-9-19(16,17)12-6-4-3-5-11(12)14-10/h2-6,9,14H,1,7-8H2 |
| InChIKey | DTVCAGZYFZJRBJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate?
The IUPAC name of prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate (CID 68872574) is prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate.
What is the SMILES notation for prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate?
The canonical SMILES for prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate is C=CCOC(=O)CC1=CS(=O)(=O)c2ccccc2N1.
What is the InChIKey of prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate?
The InChIKey is DTVCAGZYFZJRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4S/c1-2-7-18-13(15)8-10-9-19(16,17)12-6-4-3-5-11(12)14-10/h2-6,9,14H,1,7-8H2.
What are the key properties of prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate?
prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate has a molecular weight of 279.32 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-(1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)acetate is sourced from PubChem (CID 68872574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).