About 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine
2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine (PubChem CID 68872828) has the molecular formula C28H33FN2O2
and a molecular weight of 448.58 g/mol. Its IUPAC name is 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine.
Molecular Properties
| Compound Name | 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine |
| PubChem CID | 68872828 |
| Molecular Formula | C28H33FN2O2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine |
| SMILES | CCOc1cc(CN2CCC(c3ncccc3C)CC2)cc(OCC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H33FN2O2/c1-4-32-25-17-21(18-26(33-5-2)27(25)22-8-10-24(29)11-9-22)19-31-15-12-23(13-16-31)28-20(3)7-6-14-30-28/h6-11,14,17-18,23H,4-5,12-13,15-16,19H2,1-3H3 |
| InChIKey | URAFEDZVFYWWOJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine?
The IUPAC name of 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine (CID 68872828) is 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine.
What is the SMILES notation for 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine?
The canonical SMILES for 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine is CCOc1cc(CN2CCC(c3ncccc3C)CC2)cc(OCC)c1-c1ccc(F)cc1.
What is the InChIKey of 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine?
The InChIKey is URAFEDZVFYWWOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H33FN2O2/c1-4-32-25-17-21(18-26(33-5-2)27(25)22-8-10-24(29)11-9-22)19-31-15-12-23(13-16-31)28-20(3)7-6-14-30-28/h6-11,14,17-18,23H,4-5,12-13,15-16,19H2,1-3H3.
What are the key properties of 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine?
2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine has a molecular weight of 448.58 g/mol, XLogP of 6.37, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl]piperidin-4-yl]-3-methylpyridine is sourced from PubChem (CID 68872828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).