About 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine
6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine (PubChem CID 68873241) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine.
Analyze 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine?
The IUPAC name of 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine (CID 68873241) is 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine?
The canonical SMILES for 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine is CC1Cc2nc[nH]c2CN1.
What is the InChIKey of 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine?
The InChIKey is YCOVRCITPNPDDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-5-2-6-7(3-8-5)10-4-9-6/h4-5,8H,2-3H2,1H3,(H,9,10).
What are the key properties of 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine?
6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine has a molecular weight of 137.19 g/mol, XLogP of 0.44, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 68873241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).