C26H30F2N4O2 — CID 68873251
N-[3,5-difluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]-2-ethylbutanamide (PubChem CID 68873251) has the molecular formula C26H30F2N4O2 and a molecular weight of 468.55 g/mol. Its IUPAC name is N-[3,5-difluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]-2-ethylbutanamide.
| Compound Name | N-[3,5-difluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 68873251 |
| Molecular Formula | C26H30F2N4O2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[3,5-difluoro-4-[4-[1,3-oxazol-2-yl(phenyl)methyl]piperazin-1-yl]phenyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1cc(F)c(N2CCN(C(c3ccccc3)c3ncco3)CC2)c(F)c1 |
| InChI | InChI=1S/C26H30F2N4O2/c1-3-18(4-2)25(33)30-20-16-21(27)24(22(28)17-20)32-13-11-31(12-14-32)23(26-29-10-15-34-26)19-8-6-5-7-9-19/h5-10,15-18,23H,3-4,11-14H2,1-2H3,(H,30,33) |
| InChIKey | OMGWNNSFPFTYSB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|