C15H13F3N4O — CID 68873565
7-pyridin-4-yl-1-(4,4,4-trifluorobut-2-enyl)-2,3-dihydroimidazo[1,2-a]pyrimidin-5-one (PubChem CID 68873565) has the molecular formula C15H13F3N4O and a molecular weight of 322.29 g/mol. Its IUPAC name is 7-pyridin-4-yl-1-(4,4,4-trifluorobut-2-enyl)-2,3-dihydroimidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 7-pyridin-4-yl-1-(4,4,4-trifluorobut-2-enyl)-2,3-dihydroimidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 68873565 |
| Molecular Formula | C15H13F3N4O |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 7-pyridin-4-yl-1-(4,4,4-trifluorobut-2-enyl)-2,3-dihydroimidazo[1,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(-c2ccncc2)nc2n1CCN2CC=CC(F)(F)F |
| InChI | InChI=1S/C15H13F3N4O/c16-15(17,18)4-1-7-21-8-9-22-13(23)10-12(20-14(21)22)11-2-5-19-6-3-11/h1-6,10H,7-9H2 |
| InChIKey | FUWGDLPUEYXIEN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|