C11H14N2O3 — CID 68873862
4-(2-oxo-1H-pyridin-3-yl)piperidine-1-carboxylic acid (PubChem CID 68873862) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-(2-oxo-1H-pyridin-3-yl)piperidine-1-carboxylic acid.
| Compound Name | 4-(2-oxo-1H-pyridin-3-yl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68873862 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-(2-oxo-1H-pyridin-3-yl)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2ccc[nH]c2=O)CC1 |
| InChI | InChI=1S/C11H14N2O3/c14-10-9(2-1-5-12-10)8-3-6-13(7-4-8)11(15)16/h1-2,5,8H,3-4,6-7H2,(H,12,14)(H,15,16) |
| InChIKey | ZWCHJBOFNJLIPH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |