About N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide
N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide (PubChem CID 68874156) has the molecular formula C26H27ClN2O3S
and a molecular weight of 483.03 g/mol. Its IUPAC name is N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide |
| PubChem CID | 68874156 |
| Molecular Formula | C26H27ClN2O3S |
| Molecular Weight | 483.03 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)[C@@]1(NC(=O)C(c2ccccc2)c2ccccc2)CCCNC1 |
| InChI | InChI=1S/C26H27ClN2O3S/c1-19-22(27)14-8-15-23(19)33(31,32)26(16-9-17-28-18-26)29-25(30)24(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-8,10-15,24,28H,9,16-18H2,1H3,(H,29,30)/t26-/m0/s1 |
| InChIKey | QZNTZQGXQRFCEA-SANMLTNESA-N |
| XLogP | 4.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.03 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide?
The IUPAC name of N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide (CID 68874156) is N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide.
What is the SMILES notation for N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide?
The canonical SMILES for N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide is Cc1c(Cl)cccc1S(=O)(=O)[C@@]1(NC(=O)C(c2ccccc2)c2ccccc2)CCCNC1.
What is the InChIKey of N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide?
The InChIKey is QZNTZQGXQRFCEA-SANMLTNESA-N. The full InChI is InChI=1S/C26H27ClN2O3S/c1-19-22(27)14-8-15-23(19)33(31,32)26(16-9-17-28-18-26)29-25(30)24(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-8,10-15,24,28H,9,16-18H2,1H3,(H,29,30)/t26-/m0/s1.
What are the key properties of N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide?
N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide has a molecular weight of 483.03 g/mol, XLogP of 4.45, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-3-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]-2,2-diphenylacetamide is sourced from PubChem (CID 68874156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).