C19H17BrN2O2 — CID 68874259
3-[3-bromo-4-[(4-methoxyphenyl)methoxy]phenyl]pyridin-2-amine (PubChem CID 68874259) has the molecular formula C19H17BrN2O2 and a molecular weight of 385.26 g/mol. Its IUPAC name is 3-[3-bromo-4-[(4-methoxyphenyl)methoxy]phenyl]pyridin-2-amine.
| Compound Name | 3-[3-bromo-4-[(4-methoxyphenyl)methoxy]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 68874259 |
| Molecular Formula | C19H17BrN2O2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 3-[3-bromo-4-[(4-methoxyphenyl)methoxy]phenyl]pyridin-2-amine |
| SMILES | COc1ccc(COc2ccc(-c3cccnc3N)cc2Br)cc1 |
| InChI | InChI=1S/C19H17BrN2O2/c1-23-15-7-4-13(5-8-15)12-24-18-9-6-14(11-17(18)20)16-3-2-10-22-19(16)21/h2-11H,12H2,1H3,(H2,21,22) |
| InChIKey | ZDPKIBGYKBGNBH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |