C10H17F3N2O3 — CID 68875024
N-(piperidin-1-ium-4-ylmethyl)acetamide;2,2,2-trifluoroacetate (PubChem CID 68875024) has the molecular formula C10H17F3N2O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is N-(piperidin-1-ium-4-ylmethyl)acetamide;2,2,2-trifluoroacetate.
| Compound Name | N-(piperidin-1-ium-4-ylmethyl)acetamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68875024 |
| Molecular Formula | C10H17F3N2O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(piperidin-1-ium-4-ylmethyl)acetamide;2,2,2-trifluoroacetate |
| SMILES | CC(=O)NCC1CC[NH2+]CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C8H16N2O.C2HF3O2/c1-7(11)10-6-8-2-4-9-5-3-8;3-2(4,5)1(6)7/h8-9H,2-6H2,1H3,(H,10,11);(H,6,7) |
| InChIKey | MDICESWEVCXDTK-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |