About 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide
1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide (PubChem CID 68875389) has the molecular formula C8H20IN5
and a molecular weight of 313.19 g/mol. Its IUPAC name is 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide.
Molecular Properties
| Compound Name | 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide |
| PubChem CID | 68875389 |
| Molecular Formula | C8H20IN5 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide |
| SMILES | I.NN/C(N)=N/CCCN1CCCC1 |
| InChI | InChI=1S/C8H19N5.HI/c9-8(12-10)11-4-3-7-13-5-1-2-6-13;/h1-7,10H2,(H3,9,11,12);1H |
| InChIKey | DUFMJJHVXBBHJM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide?
The IUPAC name of 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide (CID 68875389) is 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide.
What is the SMILES notation for 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide?
The canonical SMILES for 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide is I.NN/C(N)=N/CCCN1CCCC1.
What is the InChIKey of 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide?
The InChIKey is DUFMJJHVXBBHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N5.HI/c9-8(12-10)11-4-3-7-13-5-1-2-6-13;/h1-7,10H2,(H3,9,11,12);1H.
What are the key properties of 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide?
1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide has a molecular weight of 313.19 g/mol, XLogP of -0.13, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-(3-pyrrolidin-1-ylpropyl)guanidine;hydroiodide is sourced from PubChem (CID 68875389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).