About 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide
3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide (PubChem CID 68875534) has the molecular formula C23H27NO4
and a molecular weight of 381.47 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide.
Molecular Properties
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide |
| PubChem CID | 68875534 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide |
| SMILES | CCC(CC)(CC(N)=O)c1ccc2oc(-c3ccc(OC)c(OC)c3)cc2c1 |
| InChI | InChI=1S/C23H27NO4/c1-5-23(6-2,14-22(24)25)17-8-10-18-16(11-17)13-20(28-18)15-7-9-19(26-3)21(12-15)27-4/h7-13H,5-6,14H2,1-4H3,(H2,24,25) |
| InChIKey | PUWSMBVKXAJLIJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide?
The IUPAC name of 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide (CID 68875534) is 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide.
What is the SMILES notation for 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide?
The canonical SMILES for 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide is CCC(CC)(CC(N)=O)c1ccc2oc(-c3ccc(OC)c(OC)c3)cc2c1.
What is the InChIKey of 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide?
The InChIKey is PUWSMBVKXAJLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO4/c1-5-23(6-2,14-22(24)25)17-8-10-18-16(11-17)13-20(28-18)15-7-9-19(26-3)21(12-15)27-4/h7-13H,5-6,14H2,1-4H3,(H2,24,25).
What are the key properties of 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide?
3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide has a molecular weight of 381.47 g/mol, XLogP of 5.05, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dimethoxyphenyl)-1-benzofuran-5-yl]-3-ethylpentanamide is sourced from PubChem (CID 68875534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).