C10H15N3O7S3 — CID 68875681
[(4S,6R)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]methyl nitrate (PubChem CID 68875681) has the molecular formula C10H15N3O7S3 and a molecular weight of 385.45 g/mol. Its IUPAC name is [(4S,6R)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]methyl nitrate.
| Compound Name | [(4S,6R)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]methyl nitrate |
|---|---|
| PubChem CID | 68875681 |
| Molecular Formula | C10H15N3O7S3 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | [(4S,6R)-4-(ethylamino)-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-6-yl]methyl nitrate |
| SMILES | CCN[C@H]1C[C@H](CO[N+](=O)[O-])S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C10H15N3O7S3/c1-2-12-8-3-6(5-20-13(14)15)22(16,17)10-7(8)4-9(21-10)23(11,18)19/h4,6,8,12H,2-3,5H2,1H3,(H2,11,18,19)/t6-,8+/m1/s1 |
| InChIKey | CVFNQWBSLVTVPD-SVRRBLITSA-N |
| XLogP | -0.20 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|