C31H31N5O2 — CID 68875724
N-[3-cyano-4-[4-[(2-methylphenyl)-phenylmethyl]piperazin-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 68875724) has the molecular formula C31H31N5O2 and a molecular weight of 505.62 g/mol. Its IUPAC name is N-[3-cyano-4-[4-[(2-methylphenyl)-phenylmethyl]piperazin-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[3-cyano-4-[4-[(2-methylphenyl)-phenylmethyl]piperazin-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 68875724 |
| Molecular Formula | C31H31N5O2 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | N-[3-cyano-4-[4-[(2-methylphenyl)-phenylmethyl]piperazin-1-yl]phenyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1ccccc1C(c1ccccc1)N1CCN(c2ccc(NC(=O)c3c(C)noc3C)cc2C#N)CC1 |
| InChI | InChI=1S/C31H31N5O2/c1-21-9-7-8-12-27(21)30(24-10-5-4-6-11-24)36-17-15-35(16-18-36)28-14-13-26(19-25(28)20-32)33-31(37)29-22(2)34-38-23(29)3/h4-14,19,30H,15-18H2,1-3H3,(H,33,37) |
| InChIKey | WEOBPFUKHDZJRL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|