About 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one
2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one (PubChem CID 68875753) has the molecular formula C9H10N4O3
and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one |
| PubChem CID | 68875753 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(NCc2cc(CO)no2)[nH]1 |
| InChI | InChI=1S/C9H10N4O3/c14-5-6-3-7(16-13-6)4-11-9-10-2-1-8(15)12-9/h1-3,14H,4-5H2,(H2,10,11,12,15) |
| InChIKey | QFPIRZYCNQHVKQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one?
The IUPAC name of 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one (CID 68875753) is 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one?
The canonical SMILES for 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one is O=c1ccnc(NCc2cc(CO)no2)[nH]1.
What is the InChIKey of 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one?
The InChIKey is QFPIRZYCNQHVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O3/c14-5-6-3-7(16-13-6)4-11-9-10-2-1-8(15)12-9/h1-3,14H,4-5H2,(H2,10,11,12,15).
What are the key properties of 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one?
2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one has a molecular weight of 222.20 g/mol, XLogP of -0.14, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(hydroxymethyl)-1,2-oxazol-5-yl]methylamino]-1H-pyrimidin-6-one is sourced from PubChem (CID 68875753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).