About 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid
7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 68876412) has the molecular formula C11H12INO2
and a molecular weight of 317.13 g/mol. Its IUPAC name is 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| PubChem CID | 68876412 |
| Molecular Formula | C11H12INO2 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | O=C(O)N1CCc2ccc(CI)cc2C1 |
| InChI | InChI=1S/C11H12INO2/c12-6-8-1-2-9-3-4-13(11(14)15)7-10(9)5-8/h1-2,5H,3-4,6-7H2,(H,14,15) |
| InChIKey | MJOZGRPMKFAONT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid?
The IUPAC name of 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (CID 68876412) is 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
What is the SMILES notation for 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid?
The canonical SMILES for 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid is O=C(O)N1CCc2ccc(CI)cc2C1.
What is the InChIKey of 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid?
The InChIKey is MJOZGRPMKFAONT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12INO2/c12-6-8-1-2-9-3-4-13(11(14)15)7-10(9)5-8/h1-2,5H,3-4,6-7H2,(H,14,15).
What are the key properties of 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid?
7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid has a molecular weight of 317.13 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(iodomethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid is sourced from PubChem (CID 68876412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).