C22H35FN2O3 — CID 68876845
propan-2-yl 8-(1-adamantylcarbamoylamino)-2-fluorooct-2-enoate (PubChem CID 68876845) has the molecular formula C22H35FN2O3 and a molecular weight of 394.53 g/mol. Its IUPAC name is propan-2-yl 8-(1-adamantylcarbamoylamino)-2-fluorooct-2-enoate.
| Compound Name | propan-2-yl 8-(1-adamantylcarbamoylamino)-2-fluorooct-2-enoate |
|---|---|
| PubChem CID | 68876845 |
| Molecular Formula | C22H35FN2O3 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | propan-2-yl 8-(1-adamantylcarbamoylamino)-2-fluorooct-2-enoate |
| SMILES | CC(C)OC(=O)C(F)=CCCCCCNC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H35FN2O3/c1-15(2)28-20(26)19(23)7-5-3-4-6-8-24-21(27)25-22-12-16-9-17(13-22)11-18(10-16)14-22/h7,15-18H,3-6,8-14H2,1-2H3,(H2,24,25,27) |
| InChIKey | JICJABUXOIDBPB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|