C22H25FIN7O6S — CID 68877225
1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-ol;sulfamic acid (PubChem CID 68877225) has the molecular formula C22H25FIN7O6S and a molecular weight of 661.45 g/mol. Its IUPAC name is 1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-ol;sulfamic acid.
| Compound Name | 1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-ol;sulfamic acid |
|---|---|
| PubChem CID | 68877225 |
| Molecular Formula | C22H25FIN7O6S |
| Molecular Weight | 661.45 g/mol |
| Exact Mass | 661.06 |
| IUPAC Name | 1-[4-[6-amino-2-fluoro-8-[(6-iodo-1,3-benzodioxol-5-yl)methyl]purin-9-yl]but-2-ynyl]piperidin-4-ol;sulfamic acid |
| SMILES | NS(=O)(=O)O.Nc1nc(F)nc2c1nc(Cc1cc3c(cc1I)OCO3)n2CC#CCN1CCC(O)CC1 |
| InChI | InChI=1S/C22H22FIN6O3.H3NO3S/c23-22-27-20(25)19-21(28-22)30(6-2-1-5-29-7-3-14(31)4-8-29)18(26-19)10-13-9-16-17(11-15(13)24)33-12-32-16;1-5(2,3)4/h9,11,14,31H,3-8,10,12H2,(H2,25,27,28);(H3,1,2,3,4) |
| InChIKey | IOUXHDBOGWJDBW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 191.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|