C25H26N5S+ — CID 68877499
1-N,2-N-dibenzyl-3-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]benzene-1,2-diamine (PubChem CID 68877499) has the molecular formula C25H26N5S+ and a molecular weight of 428.59 g/mol. Its IUPAC name is 1-N,2-N-dibenzyl-3-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]benzene-1,2-diamine.
| Compound Name | 1-N,2-N-dibenzyl-3-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 68877499 |
| Molecular Formula | C25H26N5S+ |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-N,2-N-dibenzyl-3-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]benzene-1,2-diamine |
| SMILES | Cc1c[n+](C)c(/N=N/c2cccc(NCc3ccccc3)c2NCc2ccccc2)s1 |
| InChI | InChI=1S/C25H25N5S/c1-19-18-30(2)25(31-19)29-28-23-15-9-14-22(26-16-20-10-5-3-6-11-20)24(23)27-17-21-12-7-4-8-13-21/h3-15,18H,16-17H2,1-2H3,(H,26,28)/p+1 |
| InChIKey | JWLHGDDVFFQHGC-UHFFFAOYSA-O |
| XLogP | 6.52 |
| TPSA | 52.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|