About CID 68879023
CID 68879023 (PubChem CID 68879023) has the molecular formula C22H26BO4
and a molecular weight of 365.26 g/mol.
Molecular Properties
| Compound Name | CID 68879023 |
| PubChem CID | 68879023 |
| Molecular Formula | C22H26BO4 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | — |
| SMILES | CC1(C)CCc2cc(O[B]Oc3ccc4c(c3)CCC(C)(C)O4)ccc2O1 |
| InChI | InChI=1S/C22H26BO4/c1-21(2)11-9-15-13-17(5-7-19(15)24-21)26-23-27-18-6-8-20-16(14-18)10-12-22(3,4)25-20/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | KAVLPIPRPDGULY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68879023 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68879023?
The IUPAC name of CID 68879023 (CID 68879023) is not available.
What is the SMILES notation for CID 68879023?
The canonical SMILES for CID 68879023 is CC1(C)CCc2cc(O[B]Oc3ccc4c(c3)CCC(C)(C)O4)ccc2O1.
What is the InChIKey of CID 68879023?
The InChIKey is KAVLPIPRPDGULY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26BO4/c1-21(2)11-9-15-13-17(5-7-19(15)24-21)26-23-27-18-6-8-20-16(14-18)10-12-22(3,4)25-20/h5-8,13-14H,9-12H2,1-4H3.
What are the key properties of CID 68879023?
CID 68879023 has a molecular weight of 365.26 g/mol, XLogP of 4.89, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68879023 is sourced from PubChem (CID 68879023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).