C24H26ClNO3 — CID 68879522
4-(3-chloroprop-1-enyl)-1-pentylspiro[2H-indole-3,7'-6H-furo[2,3-f][1,3]benzodioxole] (PubChem CID 68879522) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is 4-(3-chloroprop-1-enyl)-1-pentylspiro[2H-indole-3,7'-6H-furo[2,3-f][1,3]benzodioxole].
| Compound Name | 4-(3-chloroprop-1-enyl)-1-pentylspiro[2H-indole-3,7'-6H-furo[2,3-f][1,3]benzodioxole] |
|---|---|
| PubChem CID | 68879522 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-(3-chloroprop-1-enyl)-1-pentylspiro[2H-indole-3,7'-6H-furo[2,3-f][1,3]benzodioxole] |
| SMILES | CCCCCN1CC2(COc3cc4c(cc32)OCO4)c2c(C=CCCl)cccc21 |
| InChI | InChI=1S/C24H26ClNO3/c1-2-3-4-11-26-14-24(23-17(8-6-10-25)7-5-9-19(23)26)15-27-20-13-22-21(12-18(20)24)28-16-29-22/h5-9,12-13H,2-4,10-11,14-16H2,1H3 |
| InChIKey | HRRJYMYRJLPLRX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|