About 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole
6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole (PubChem CID 68879618) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole.
Analyze 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole?
The IUPAC name of 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole (CID 68879618) is 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole.
What is the SMILES notation for 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole?
The canonical SMILES for 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole is CCc1sc2nncn2c1C.
What is the InChIKey of 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole?
The InChIKey is QOIKNMZCLQYNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S/c1-3-6-5(2)10-4-8-9-7(10)11-6/h4H,3H2,1-2H3.
What are the key properties of 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole?
6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole has a molecular weight of 167.24 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5-methyl-[1,3]thiazolo[2,3-c][1,2,4]triazole is sourced from PubChem (CID 68879618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).