About 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid
1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid (PubChem CID 68880418) has the molecular formula C18H14ClIN2O3
and a molecular weight of 468.68 g/mol. Its IUPAC name is 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid |
| PubChem CID | 68880418 |
| Molecular Formula | C18H14ClIN2O3 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 467.97 |
| IUPAC Name | 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid |
| SMILES | CC(c1ccccc1Cl)N(C(=O)O)c1conc1-c1ccc(I)cc1 |
| InChI | InChI=1S/C18H14ClIN2O3/c1-11(14-4-2-3-5-15(14)19)22(18(23)24)16-10-25-21-17(16)12-6-8-13(20)9-7-12/h2-11H,1H3,(H,23,24) |
| InChIKey | CHHPMLKIAVHHMC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid?
The IUPAC name of 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid (CID 68880418) is 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid.
What is the SMILES notation for 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid?
The canonical SMILES for 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid is CC(c1ccccc1Cl)N(C(=O)O)c1conc1-c1ccc(I)cc1.
What is the InChIKey of 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid?
The InChIKey is CHHPMLKIAVHHMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClIN2O3/c1-11(14-4-2-3-5-15(14)19)22(18(23)24)16-10-25-21-17(16)12-6-8-13(20)9-7-12/h2-11H,1H3,(H,23,24).
What are the key properties of 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid?
1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid has a molecular weight of 468.68 g/mol, XLogP of 5.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)ethyl-[3-(4-iodophenyl)-1,2-oxazol-4-yl]carbamic acid is sourced from PubChem (CID 68880418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).