C23H27N3 — CID 68880580
3-[2-(1H-indol-3-ylmethyl)-2-azabicyclo[3.3.1]nonan-5-yl]aniline (PubChem CID 68880580) has the molecular formula C23H27N3 and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-ylmethyl)-2-azabicyclo[3.3.1]nonan-5-yl]aniline.
| Compound Name | 3-[2-(1H-indol-3-ylmethyl)-2-azabicyclo[3.3.1]nonan-5-yl]aniline |
|---|---|
| PubChem CID | 68880580 |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 3-[2-(1H-indol-3-ylmethyl)-2-azabicyclo[3.3.1]nonan-5-yl]aniline |
| SMILES | Nc1cccc(C23CCCC(C2)N(Cc2c[nH]c4ccccc24)CC3)c1 |
| InChI | InChI=1S/C23H27N3/c24-19-6-3-5-18(13-19)23-10-4-7-20(14-23)26(12-11-23)16-17-15-25-22-9-2-1-8-21(17)22/h1-3,5-6,8-9,13,15,20,25H,4,7,10-12,14,16,24H2 |
| InChIKey | LQHCJADFLSORSX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|