C23H32FNO6 — CID 68880675
1-O-tert-butyl 3-O,5-O-diethyl 4-(3-fluoro-2-methylphenyl)piperidine-1,3,5-tricarboxylate (PubChem CID 68880675) has the molecular formula C23H32FNO6 and a molecular weight of 437.51 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O,5-O-diethyl 4-(3-fluoro-2-methylphenyl)piperidine-1,3,5-tricarboxylate.
| Compound Name | 1-O-tert-butyl 3-O,5-O-diethyl 4-(3-fluoro-2-methylphenyl)piperidine-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 68880675 |
| Molecular Formula | C23H32FNO6 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-O-tert-butyl 3-O,5-O-diethyl 4-(3-fluoro-2-methylphenyl)piperidine-1,3,5-tricarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CC(C(=O)OCC)C1c1cccc(F)c1C |
| InChI | InChI=1S/C23H32FNO6/c1-7-29-20(26)16-12-25(22(28)31-23(4,5)6)13-17(21(27)30-8-2)19(16)15-10-9-11-18(24)14(15)3/h9-11,16-17,19H,7-8,12-13H2,1-6H3 |
| InChIKey | WHWSNCXKPKQLBZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|