About ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate
ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate (PubChem CID 68880831) has the molecular formula C38H59NO5
and a molecular weight of 609.89 g/mol. Its IUPAC name is ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate |
| PubChem CID | 68880831 |
| Molecular Formula | C38H59NO5 |
| Molecular Weight | 609.89 g/mol |
| Exact Mass | 609.44 |
| IUPAC Name | ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC1C(O)(c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H59NO5/c1-16-44-33(40)39-19-17-18-30(39)38(41,24-20-26(34(2,3)4)31(42-14)27(21-24)35(5,6)7)25-22-28(36(8,9)10)32(43-15)29(23-25)37(11,12)13/h20-23,30,41H,16-19H2,1-15H3 |
| InChIKey | QDMMBVMWIBHQMY-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 609.89 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate?
The IUPAC name of ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate (CID 68880831) is ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate?
The canonical SMILES for ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate is CCOC(=O)N1CCCC1C(O)(c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1.
What is the InChIKey of ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate?
The InChIKey is QDMMBVMWIBHQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H59NO5/c1-16-44-33(40)39-19-17-18-30(39)38(41,24-20-26(34(2,3)4)31(42-14)27(21-24)35(5,6)7)25-22-28(36(8,9)10)32(43-15)29(23-25)37(11,12)13/h20-23,30,41H,16-19H2,1-15H3.
What are the key properties of ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate?
ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate has a molecular weight of 609.89 g/mol, XLogP of 8.75, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[bis(3,5-ditert-butyl-4-methoxyphenyl)-hydroxymethyl]pyrrolidine-1-carboxylate is sourced from PubChem (CID 68880831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).