About [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid
[3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid (PubChem CID 68881055) has the molecular formula C18H16ClN3O3
and a molecular weight of 357.80 g/mol. Its IUPAC name is [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid.
Molecular Properties
| Compound Name | [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid |
| PubChem CID | 68881055 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid |
| SMILES | CC(c1ccccc1Cl)N(C(=O)O)c1conc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C18H16ClN3O3/c1-11(14-4-2-3-5-15(14)19)22(18(23)24)16-10-25-21-17(16)12-6-8-13(20)9-7-12/h2-11H,20H2,1H3,(H,23,24) |
| InChIKey | HGJZHGYFBLBSDJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid?
The IUPAC name of [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid (CID 68881055) is [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid.
What is the SMILES notation for [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid?
The canonical SMILES for [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid is CC(c1ccccc1Cl)N(C(=O)O)c1conc1-c1ccc(N)cc1.
What is the InChIKey of [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid?
The InChIKey is HGJZHGYFBLBSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN3O3/c1-11(14-4-2-3-5-15(14)19)22(18(23)24)16-10-25-21-17(16)12-6-8-13(20)9-7-12/h2-11H,20H2,1H3,(H,23,24).
What are the key properties of [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid?
[3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid has a molecular weight of 357.80 g/mol, XLogP of 4.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-aminophenyl)-1,2-oxazol-4-yl]-[1-(2-chlorophenyl)ethyl]carbamic acid is sourced from PubChem (CID 68881055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).