C24H22Cl2FN3O2 — CID 68881492
(3R,5S)-3-[[2,6-dichloro-4-(4-fluorophenoxy)phenyl]methyl]-5-(4,5,6,7-tetrahydro-1H-indazol-5-yl)pyrrolidin-2-one (PubChem CID 68881492) has the molecular formula C24H22Cl2FN3O2 and a molecular weight of 474.36 g/mol. Its IUPAC name is (3R,5S)-3-[[2,6-dichloro-4-(4-fluorophenoxy)phenyl]methyl]-5-(4,5,6,7-tetrahydro-1H-indazol-5-yl)pyrrolidin-2-one.
| Compound Name | (3R,5S)-3-[[2,6-dichloro-4-(4-fluorophenoxy)phenyl]methyl]-5-(4,5,6,7-tetrahydro-1H-indazol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 68881492 |
| Molecular Formula | C24H22Cl2FN3O2 |
| Molecular Weight | 474.36 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (3R,5S)-3-[[2,6-dichloro-4-(4-fluorophenoxy)phenyl]methyl]-5-(4,5,6,7-tetrahydro-1H-indazol-5-yl)pyrrolidin-2-one |
| SMILES | O=C1N[C@H](C2CCc3[nH]ncc3C2)C[C@H]1Cc1c(Cl)cc(Oc2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C24H22Cl2FN3O2/c25-20-10-18(32-17-4-2-16(27)3-5-17)11-21(26)19(20)8-14-9-23(29-24(14)31)13-1-6-22-15(7-13)12-28-30-22/h2-5,10-14,23H,1,6-9H2,(H,28,30)(H,29,31)/t13?,14-,23+/m1/s1 |
| InChIKey | INQSIMADIXKXLL-OYUUFYGXSA-N |
| XLogP | 5.50 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |