About 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid
4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 68882034) has the molecular formula C9H11N3O3S
and a molecular weight of 241.27 g/mol. Its IUPAC name is 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 68882034 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(N2CCCNC2=O)sc1C(=O)O |
| InChI | InChI=1S/C9H11N3O3S/c1-5-6(7(13)14)16-9(11-5)12-4-2-3-10-8(12)15/h2-4H2,1H3,(H,10,15)(H,13,14) |
| InChIKey | DZMVBNWCAGXUMN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid (CID 68882034) is 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid is Cc1nc(N2CCCNC2=O)sc1C(=O)O.
What is the InChIKey of 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is DZMVBNWCAGXUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O3S/c1-5-6(7(13)14)16-9(11-5)12-4-2-3-10-8(12)15/h2-4H2,1H3,(H,10,15)(H,13,14).
What are the key properties of 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid?
4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 241.27 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(2-oxo-1,3-diazinan-1-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 68882034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).