About 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea
1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea (PubChem CID 68882248) has the molecular formula C17H15N5O2S
and a molecular weight of 353.41 g/mol. Its IUPAC name is 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea.
Molecular Properties
| Compound Name | 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea |
| PubChem CID | 68882248 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea |
| SMILES | CN(C)NC(=O)Nc1cccc2c1C(=O)C1=C(c3ccsc3)N=NC12 |
| InChI | InChI=1S/C17H15N5O2S/c1-22(2)21-17(24)18-11-5-3-4-10-12(11)16(23)13-14(19-20-15(10)13)9-6-7-25-8-9/h3-8,15H,1-2H3,(H2,18,21,24) |
| InChIKey | XCZPQMXTVKQRLY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea?
The IUPAC name of 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea (CID 68882248) is 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea.
What is the SMILES notation for 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea?
The canonical SMILES for 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea is CN(C)NC(=O)Nc1cccc2c1C(=O)C1=C(c3ccsc3)N=NC12.
What is the InChIKey of 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea?
The InChIKey is XCZPQMXTVKQRLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5O2S/c1-22(2)21-17(24)18-11-5-3-4-10-12(11)16(23)13-14(19-20-15(10)13)9-6-7-25-8-9/h3-8,15H,1-2H3,(H2,18,21,24).
What are the key properties of 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea?
1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea has a molecular weight of 353.41 g/mol, XLogP of 3.46, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)-3-(4-oxo-3-thiophen-3-yl-8bH-indeno[1,2-c]pyrazol-5-yl)urea is sourced from PubChem (CID 68882248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).