C15H19BrN2 — CID 68882263
3-(6-bromo-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine (PubChem CID 68882263) has the molecular formula C15H19BrN2 and a molecular weight of 307.24 g/mol. Its IUPAC name is 3-(6-bromo-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine.
| Compound Name | 3-(6-bromo-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine |
|---|---|
| PubChem CID | 68882263 |
| Molecular Formula | C15H19BrN2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-(6-bromo-1,2,3,4-tetrahydrocarbazol-9-yl)propan-1-amine |
| SMILES | NCCCn1c2c(c3cc(Br)ccc31)CCCC2 |
| InChI | InChI=1S/C15H19BrN2/c16-11-6-7-15-13(10-11)12-4-1-2-5-14(12)18(15)9-3-8-17/h6-7,10H,1-5,8-9,17H2 |
| InChIKey | AWFMBXGOXIAUPW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|