C29H30N2O4 — CID 68882314
2-[(3R,5R)-3,5-dibenzoyl-4-(2-hydroxyphenyl)piperidin-1-yl]-N,N-dimethylacetamide (PubChem CID 68882314) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[(3R,5R)-3,5-dibenzoyl-4-(2-hydroxyphenyl)piperidin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3R,5R)-3,5-dibenzoyl-4-(2-hydroxyphenyl)piperidin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 68882314 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-[(3R,5R)-3,5-dibenzoyl-4-(2-hydroxyphenyl)piperidin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C[C@H](C(=O)c2ccccc2)C(c2ccccc2O)[C@@H](C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C29H30N2O4/c1-30(2)26(33)19-31-17-23(28(34)20-11-5-3-6-12-20)27(22-15-9-10-16-25(22)32)24(18-31)29(35)21-13-7-4-8-14-21/h3-16,23-24,27,32H,17-19H2,1-2H3/t23-,24-/m0/s1 |
| InChIKey | DIDKMPHGHUKQGR-ZEQRLZLVSA-N |
| XLogP | 3.88 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |