C14H30N2 — CID 68883231
2,5-dimethylpyrrolidine;2,2,5,5-tetramethylpyrrolidine (PubChem CID 68883231) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 2,5-dimethylpyrrolidine;2,2,5,5-tetramethylpyrrolidine.
| Compound Name | 2,5-dimethylpyrrolidine;2,2,5,5-tetramethylpyrrolidine |
|---|---|
| PubChem CID | 68883231 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 2,5-dimethylpyrrolidine;2,2,5,5-tetramethylpyrrolidine |
| SMILES | CC1(C)CCC(C)(C)N1.CC1CCC(C)N1 |
| InChI | InChI=1S/C8H17N.C6H13N/c1-7(2)5-6-8(3,4)9-7;1-5-3-4-6(2)7-5/h9H,5-6H2,1-4H3;5-7H,3-4H2,1-2H3 |
| InChIKey | WMYWPYRCFKDQCM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |