C19H25NO4 — CID 68883250
7-[3-[[(2R,3R)-3-hydroxy-2-methylbutyl]amino]prop-1-ynyl]-2,3,4,5-tetrahydro-1-benzoxepine-9-carboxylic acid (PubChem CID 68883250) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 7-[3-[[(2R,3R)-3-hydroxy-2-methylbutyl]amino]prop-1-ynyl]-2,3,4,5-tetrahydro-1-benzoxepine-9-carboxylic acid.
| Compound Name | 7-[3-[[(2R,3R)-3-hydroxy-2-methylbutyl]amino]prop-1-ynyl]-2,3,4,5-tetrahydro-1-benzoxepine-9-carboxylic acid |
|---|---|
| PubChem CID | 68883250 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 7-[3-[[(2R,3R)-3-hydroxy-2-methylbutyl]amino]prop-1-ynyl]-2,3,4,5-tetrahydro-1-benzoxepine-9-carboxylic acid |
| SMILES | C[C@H](CNCC#Cc1cc2c(c(C(=O)O)c1)OCCCC2)[C@@H](C)O |
| InChI | InChI=1S/C19H25NO4/c1-13(14(2)21)12-20-8-5-6-15-10-16-7-3-4-9-24-18(16)17(11-15)19(22)23/h10-11,13-14,20-21H,3-4,7-9,12H2,1-2H3,(H,22,23)/t13-,14-/m1/s1 |
| InChIKey | ZILXWLRLMGXVBA-ZIAGYGMSSA-N |
| XLogP | 2.06 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|