C22H25NO5S — CID 68883339
3-ethoxy-3-[4-[3-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)propoxy]phenyl]propanoic acid (PubChem CID 68883339) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is 3-ethoxy-3-[4-[3-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)propoxy]phenyl]propanoic acid.
| Compound Name | 3-ethoxy-3-[4-[3-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68883339 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-ethoxy-3-[4-[3-(5-methyl-2-thiophen-2-yl-1,3-oxazol-4-yl)propoxy]phenyl]propanoic acid |
| SMILES | CCOC(CC(=O)O)c1ccc(OCCCc2nc(-c3cccs3)oc2C)cc1 |
| InChI | InChI=1S/C22H25NO5S/c1-3-26-19(14-21(24)25)16-8-10-17(11-9-16)27-12-4-6-18-15(2)28-22(23-18)20-7-5-13-29-20/h5,7-11,13,19H,3-4,6,12,14H2,1-2H3,(H,24,25) |
| InChIKey | DSAJPBQMKOPBAN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|