About N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine
N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine (PubChem CID 68883382) has the molecular formula C27H37Cl2N
and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine.
Molecular Properties
| Compound Name | N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine |
| PubChem CID | 68883382 |
| Molecular Formula | C27H37Cl2N |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine |
| SMILES | CCN(CC=Cc1cc(Cl)c(C2C3CC4CC(C3)CC2C4)c(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C27H37Cl2N/c1-2-30(23-8-4-3-5-9-23)10-6-7-18-16-24(28)27(25(29)17-18)26-21-12-19-11-20(14-21)15-22(26)13-19/h6-7,16-17,19-23,26H,2-5,8-15H2,1H3 |
| InChIKey | PSJNVUMNHFTSSI-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine?
The IUPAC name of N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine (CID 68883382) is N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine.
What is the SMILES notation for N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine?
The canonical SMILES for N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine is CCN(CC=Cc1cc(Cl)c(C2C3CC4CC(C3)CC2C4)c(Cl)c1)C1CCCCC1.
What is the InChIKey of N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine?
The InChIKey is PSJNVUMNHFTSSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H37Cl2N/c1-2-30(23-8-4-3-5-9-23)10-6-7-18-16-24(28)27(25(29)17-18)26-21-12-19-11-20(14-21)15-22(26)13-19/h6-7,16-17,19-23,26H,2-5,8-15H2,1H3.
What are the key properties of N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine?
N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine has a molecular weight of 446.51 g/mol, XLogP of 8.20, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[4-(2-adamantyl)-3,5-dichlorophenyl]prop-2-enyl]-N-ethylcyclohexanamine is sourced from PubChem (CID 68883382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).