About 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one
4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one (PubChem CID 68884197) has the molecular formula C12H11F3N2O3S
and a molecular weight of 320.29 g/mol. Its IUPAC name is 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
| PubChem CID | 68884197 |
| Molecular Formula | C12H11F3N2O3S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
| SMILES | Cc1cccc(S(=O)(=O)Cc2c(C(F)(F)F)[nH][nH]c2=O)c1 |
| InChI | InChI=1S/C12H11F3N2O3S/c1-7-3-2-4-8(5-7)21(19,20)6-9-10(12(13,14)15)16-17-11(9)18/h2-5H,6H2,1H3,(H2,16,17,18) |
| InChIKey | CZXSHPGCCROKHV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one?
The IUPAC name of 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one (CID 68884197) is 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one?
The canonical SMILES for 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one is Cc1cccc(S(=O)(=O)Cc2c(C(F)(F)F)[nH][nH]c2=O)c1.
What is the InChIKey of 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one?
The InChIKey is CZXSHPGCCROKHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2O3S/c1-7-3-2-4-8(5-7)21(19,20)6-9-10(12(13,14)15)16-17-11(9)18/h2-5H,6H2,1H3,(H2,16,17,18).
What are the key properties of 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one?
4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one has a molecular weight of 320.29 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-methylphenyl)sulfonylmethyl]-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 68884197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).