C21H22F3N3O4S — CID 68885330
N-[(4-cyanophenyl)methyl]-N-methyl-2-[2-[methyl-[2-(trifluoromethyl)phenyl]sulfonylamino]ethoxy]acetamide (PubChem CID 68885330) has the molecular formula C21H22F3N3O4S and a molecular weight of 469.49 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-N-methyl-2-[2-[methyl-[2-(trifluoromethyl)phenyl]sulfonylamino]ethoxy]acetamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-N-methyl-2-[2-[methyl-[2-(trifluoromethyl)phenyl]sulfonylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 68885330 |
| Molecular Formula | C21H22F3N3O4S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-N-methyl-2-[2-[methyl-[2-(trifluoromethyl)phenyl]sulfonylamino]ethoxy]acetamide |
| SMILES | CN(Cc1ccc(C#N)cc1)C(=O)COCCN(C)S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H22F3N3O4S/c1-26(14-17-9-7-16(13-25)8-10-17)20(28)15-31-12-11-27(2)32(29,30)19-6-4-3-5-18(19)21(22,23)24/h3-10H,11-12,14-15H2,1-2H3 |
| InChIKey | DJLXCEBWZPPUSM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|