C28H34BrN3O5S — CID 68885460
amino 1-[(4-bromophenyl)methyl]-4-[4-(4-piperidin-4-ylbut-2-ynoxy)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 68885460) has the molecular formula C28H34BrN3O5S and a molecular weight of 604.57 g/mol. Its IUPAC name is amino 1-[(4-bromophenyl)methyl]-4-[4-(4-piperidin-4-ylbut-2-ynoxy)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | amino 1-[(4-bromophenyl)methyl]-4-[4-(4-piperidin-4-ylbut-2-ynoxy)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 68885460 |
| Molecular Formula | C28H34BrN3O5S |
| Molecular Weight | 604.57 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | amino 1-[(4-bromophenyl)methyl]-4-[4-(4-piperidin-4-ylbut-2-ynoxy)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | NOC(=O)C1(S(=O)(=O)c2ccc(OCC#CCC3CCNCC3)cc2)CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C28H34BrN3O5S/c29-24-6-4-23(5-7-24)21-32-18-14-28(15-19-32,27(33)37-30)38(34,35)26-10-8-25(9-11-26)36-20-2-1-3-22-12-16-31-17-13-22/h4-11,22,31H,3,12-21,30H2 |
| InChIKey | BFWIMMVFTZQIIY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|