C24H23F3N6O6S3 — CID 68885977
5,5-bis[1-(2-methylsulfonylpyrimidin-4-yl)ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione (PubChem CID 68885977) has the molecular formula C24H23F3N6O6S3 and a molecular weight of 644.68 g/mol. Its IUPAC name is 5,5-bis[1-(2-methylsulfonylpyrimidin-4-yl)ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-bis[1-(2-methylsulfonylpyrimidin-4-yl)ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 68885977 |
| Molecular Formula | C24H23F3N6O6S3 |
| Molecular Weight | 644.68 g/mol |
| Exact Mass | 644.08 |
| IUPAC Name | 5,5-bis[1-(2-methylsulfonylpyrimidin-4-yl)ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC(c1ccnc(S(C)(=O)=O)n1)C1(C(C)c2ccnc(S(C)(=O)=O)n2)NC(=O)N(c2ccc(SC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C24H23F3N6O6S3/c1-13(17-9-11-28-20(30-17)41(3,36)37)23(14(2)18-10-12-29-21(31-18)42(4,38)39)19(34)33(22(35)32-23)15-5-7-16(8-6-15)40-24(25,26)27/h5-14H,1-4H3,(H,32,35) |
| InChIKey | IFZIXGGDSSHYCK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 169.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|