C19H19N3O2S — CID 68886449
2-[5-[4-(4-methylsulfanylphenyl)phenyl]-1H-imidazol-2-yl]ethylcarbamic acid (PubChem CID 68886449) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-[5-[4-(4-methylsulfanylphenyl)phenyl]-1H-imidazol-2-yl]ethylcarbamic acid.
| Compound Name | 2-[5-[4-(4-methylsulfanylphenyl)phenyl]-1H-imidazol-2-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 68886449 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-[5-[4-(4-methylsulfanylphenyl)phenyl]-1H-imidazol-2-yl]ethylcarbamic acid |
| SMILES | CSc1ccc(-c2ccc(-c3cnc(CCNC(=O)O)[nH]3)cc2)cc1 |
| InChI | InChI=1S/C19H19N3O2S/c1-25-16-8-6-14(7-9-16)13-2-4-15(5-3-13)17-12-21-18(22-17)10-11-20-19(23)24/h2-9,12,20H,10-11H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | BQWZEPBYXGTGSG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |