C27H32N4O4 — CID 68886471
2-(3-hydroxyphenyl)-13-methoxy-8-methyl-6-[2-(propan-2-ylamino)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 68886471) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-13-methoxy-8-methyl-6-[2-(propan-2-ylamino)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 2-(3-hydroxyphenyl)-13-methoxy-8-methyl-6-[2-(propan-2-ylamino)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 68886471 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 2-(3-hydroxyphenyl)-13-methoxy-8-methyl-6-[2-(propan-2-ylamino)ethyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC1(C)C(=O)N(CCNC(C)C)CC(=O)N1C3c1cccc(O)c1 |
| InChI | InChI=1S/C27H32N4O4/c1-16(2)28-10-11-30-15-23(33)31-25(17-6-5-7-18(32)12-17)24-21(14-27(31,3)26(30)34)20-13-19(35-4)8-9-22(20)29-24/h5-9,12-13,16,25,28-29,32H,10-11,14-15H2,1-4H3 |
| InChIKey | UESVXUAYSCUWOM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|