C22H19N5O4 — CID 68886794
[4-[[2-[(2-methylindazol-6-yl)carbamoyl]anilino]methyl]-2-pyridinyl] hydrogen carbonate (PubChem CID 68886794) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is [4-[[2-[(2-methylindazol-6-yl)carbamoyl]anilino]methyl]-2-pyridinyl] hydrogen carbonate.
| Compound Name | [4-[[2-[(2-methylindazol-6-yl)carbamoyl]anilino]methyl]-2-pyridinyl] hydrogen carbonate |
|---|---|
| PubChem CID | 68886794 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [4-[[2-[(2-methylindazol-6-yl)carbamoyl]anilino]methyl]-2-pyridinyl] hydrogen carbonate |
| SMILES | Cn1cc2ccc(NC(=O)c3ccccc3NCc3ccnc(OC(=O)O)c3)cc2n1 |
| InChI | InChI=1S/C22H19N5O4/c1-27-13-15-6-7-16(11-19(15)26-27)25-21(28)17-4-2-3-5-18(17)24-12-14-8-9-23-20(10-14)31-22(29)30/h2-11,13,24H,12H2,1H3,(H,25,28)(H,29,30) |
| InChIKey | MEWITEQZJCOENN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |