C38H41F2NO3Si — CID 68887446
tert-butyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2,5-difluorophenyl)-5-phenyl-2,5-dihydropyrrole-1-carboxylate (PubChem CID 68887446) has the molecular formula C38H41F2NO3Si and a molecular weight of 625.83 g/mol. Its IUPAC name is tert-butyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2,5-difluorophenyl)-5-phenyl-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2,5-difluorophenyl)-5-phenyl-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 68887446 |
| Molecular Formula | C38H41F2NO3Si |
| Molecular Weight | 625.83 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | tert-butyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(2,5-difluorophenyl)-5-phenyl-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(c2cc(F)ccc2F)=CC1c1ccccc1 |
| InChI | InChI=1S/C38H41F2NO3Si/c1-37(2,3)44-36(42)41-34(27-16-10-7-11-17-27)25-32(31-24-28(39)22-23-33(31)40)35(41)26-43-45(38(4,5)6,29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-25,34-35H,26H2,1-6H3 |
| InChIKey | UVJAJGXDSRSLSM-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.83 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|