C15H11BrFN — CID 68887450
2-(bromomethylidene)-13-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 68887450) has the molecular formula C15H11BrFN and a molecular weight of 304.16 g/mol. Its IUPAC name is 2-(bromomethylidene)-13-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 2-(bromomethylidene)-13-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 68887450 |
| Molecular Formula | C15H11BrFN |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2-(bromomethylidene)-13-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | Fc1ccc2c(c1)CCc1ncccc1C2=CBr |
| InChI | InChI=1S/C15H11BrFN/c16-9-14-12-5-4-11(17)8-10(12)3-6-15-13(14)2-1-7-18-15/h1-2,4-5,7-9H,3,6H2 |
| InChIKey | CSQIDPWNJSSROZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |