C26H27F3N4O5 — CID 68887776
N-[1-oxo-1-[6-oxo-4-(2-pyridin-3-ylacetyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 68887776) has the molecular formula C26H27F3N4O5 and a molecular weight of 532.52 g/mol. Its IUPAC name is N-[1-oxo-1-[6-oxo-4-(2-pyridin-3-ylacetyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[1-oxo-1-[6-oxo-4-(2-pyridin-3-ylacetyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 68887776 |
| Molecular Formula | C26H27F3N4O5 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | N-[1-oxo-1-[6-oxo-4-(2-pyridin-3-ylacetyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | CCCC(NC(=O)c1ccc(OC(F)(F)F)cc1)C(=O)N1CCC2C1C(=O)CN2C(=O)Cc1cccnc1 |
| InChI | InChI=1S/C26H27F3N4O5/c1-2-4-19(31-24(36)17-6-8-18(9-7-17)38-26(27,28)29)25(37)32-12-10-20-23(32)21(34)15-33(20)22(35)13-16-5-3-11-30-14-16/h3,5-9,11,14,19-20,23H,2,4,10,12-13,15H2,1H3,(H,31,36) |
| InChIKey | BGAHPKVOFLPGGP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |