C18H15BrN2O2 — CID 68888725
(1R)-4-(4-bromonaphthalen-1-yl)-2,4-diazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 68888725) has the molecular formula C18H15BrN2O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is (1R)-4-(4-bromonaphthalen-1-yl)-2,4-diazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R)-4-(4-bromonaphthalen-1-yl)-2,4-diazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 68888725 |
| Molecular Formula | C18H15BrN2O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (1R)-4-(4-bromonaphthalen-1-yl)-2,4-diazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1C2C3CC[C@H](C3)N2C(=O)N1c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C18H15BrN2O2/c19-14-7-8-15(13-4-2-1-3-12(13)14)21-17(22)16-10-5-6-11(9-10)20(16)18(21)23/h1-4,7-8,10-11,16H,5-6,9H2/t10?,11-,16?/m1/s1 |
| InChIKey | NNQHBUXTDOASGT-NOEPWBJOSA-N |
| XLogP | 3.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|