About (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate
(3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate (PubChem CID 68888970) has the molecular formula C17H12N4O2S
and a molecular weight of 336.38 g/mol. Its IUPAC name is (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate.
Molecular Properties
| Compound Name | (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate |
| PubChem CID | 68888970 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate |
| SMILES | NC(=O)Oc1[nH]c2cccnc2c1Sc1cccc2cccnc12 |
| InChI | InChI=1S/C17H12N4O2S/c18-17(22)23-16-15(14-11(21-16)6-3-9-20-14)24-12-7-1-4-10-5-2-8-19-13(10)12/h1-9,21H,(H2,18,22) |
| InChIKey | WPOPGLWCZYVKPX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate?
The IUPAC name of (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate (CID 68888970) is (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate.
What is the SMILES notation for (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate?
The canonical SMILES for (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate is NC(=O)Oc1[nH]c2cccnc2c1Sc1cccc2cccnc12.
What is the InChIKey of (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate?
The InChIKey is WPOPGLWCZYVKPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O2S/c18-17(22)23-16-15(14-11(21-16)6-3-9-20-14)24-12-7-1-4-10-5-2-8-19-13(10)12/h1-9,21H,(H2,18,22).
What are the key properties of (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate?
(3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate has a molecular weight of 336.38 g/mol, XLogP of 3.72, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-quinolin-8-ylsulfanyl-1H-pyrrolo[3,2-b]pyridin-2-yl) carbamate is sourced from PubChem (CID 68888970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).